Triphenylacetic acid is a research chemical consisting of a carboxylic acid group attached to a central carbon bearing three phenyl rings. It is commonly used as a laboratory reagent in organic synthesis and chemical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 595-91-5
2-Butanone, 3-chloro-3-methyl-
chemical synthesis intermediate
D-Alanine tert-butyl ester hydrochloride
research compound
2-Azidoadenosine
research intermediate for adenosine analogs
نفثولفثالين
pH indicator
Rhodium(II) 2,2,2-triphenylacetate
research compound for catalysis
2,2,2-triphenylacetic acid
DCYGAPKNVCQNOE-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)O