(S)-3-Phenylpiperidine is a chiral piperidine derivative used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. Its structure features an aromatic ring and a secondary amine, with a single stereocenter that defines its specific three-dimensional arrangement.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 59349-71-2
(R)-3-Phenyl-pyrrolidine hydrochloride
research compound
N-(4-Bromopentyl)phthalimide
pharmaceutical intermediate
1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol
pharmaceutical intermediate
Methyl 2-methyl-3-nitrobenzoate
Pharmaceutical intermediate
3-Phenylpiperidine
Research compound
(R)-3-Phenylpiperidine
research compound
(R)-3-Phenylpiperidine hydrochloride
Pharmaceutical intermediate
(3S)-3-phenylpiperidine
NZYBILDYPCVNMU-LLVKDONJSA-N
C1C[C@H](CNC1)C2=CC=CC=C2