Sulfone, p-chlorobenzyl methyl is a chemical compound with the structure of a sulfone bearing a p-chlorobenzyl group and a methyl group. It is identified by the canonical SMILES CS(=O)(=O)Cc1ccc(Cl)cc1 and has a molecular weight of 204.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5925-80-4
1-chloro-4-(methylsulfonylmethyl)benzene
NLAHSDOLKYATFI-UHFFFAOYSA-N
CS(=O)(=O)CC1=CC=C(C=C1)Cl