Methyl 6-chloro-5-nitronicotinate is a chemical compound used as a pharmaceutical intermediate. It features a pyridine ring with chloro, nitro, and ester functional groups, making it a building block in the synthesis of various pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 59237-53-5
2-[(Acetyloxy)methoxy]ethyl acetate
Pharmaceutical intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
Chloro(iodo)methane
Pharmaceutical intermediate
7-Hydroxy-8-methylazabicyclo(3.2.1)octan-3-one
pharmaceutical intermediate
methyl 6-chloro-5-nitropyridine-3-carboxylate
BRPREIDVQXJOJH-UHFFFAOYSA-N
COC(=O)C1=CC(=C(N=C1)Cl)[N+](=O)[O-]
—