This compound is a sulfonium salt used as a cationic photoinitiator, typically supplied as the hexafluorophosphate salt. It is designed to initiate cationic polymerization upon exposure to ultraviolet light, making it significant in UV-curable coatings and inks.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 591773-92-1
Triphenylsulfonium hexafluorophosphate
Cationic photoinitiator
1-HEXENE
Chemical intermediate and comonomer
2-Bromoethyl ethyl ether
chemical intermediate and insecticide precursor
هبتين
Organic synthesis intermediate
3-Hexadecanol
secondary fatty alcohol
10-(4-phenylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one hexafluorophosphate
UHKYZKDZFIFLBK-UHFFFAOYSA-N
CC(C)C1=CC2=C(C=C1)[S+](C3=CC=CC=C3C2=O)C4=CC=C(C=C4)C5=CC=CC=C5.F[P-](F)(F)(F)(F)F