1-Iodopropane-d7 is a deuterated research compound, specifically the heptadeuterated form of 1-iodopropane where all seven hydrogen atoms are replaced with deuterium. It is primarily used as a laboratory reagent in chemical and pharmaceutical research involving isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 59012-23-6
4-(Hydroxymethyl)benzeneboronic Acid
research reagent
3-iodo-2-(trifluoromethyl)pyridine
research compound
Potassium 1,2-naphthoquinone-4-sulphonate
analytical reagent
1-BROMO-3-IODOBENZENE
research compound
1-IODOPROPANE
Solvent and organic synthesis intermediate
Propane-1,1-d2, 1-iodo-
isotopically labeled research compound
1,1,1,2,2,3,3-heptadeuterio-3-iodopropane
PVWOIHVRPOBWPI-NCKGIQLSSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])I