This compound is an N-protected glutamic acid derivative used as a building block in solid-phase or solution-phase peptide synthesis. It features both a benzyloxycarbonyl (Cbz) protecting group on the amino terminus and a tert-butyl ester protecting group on the side-chain carboxyl, enabling selective deprotection during peptide chain assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5891-45-2
5-benzyl 1-(tert-butyl) ((benzyloxy)carbonyl)-L-glutamate
Protected glutamic acid derivative
N-alpha-t-Butyloxycarbonyl-D-glutamic acid benzyl ester
Pharmaceutical intermediate for peptide synthesis
(4S)-5-(benzyloxy)-4-{[(benzyloxy)carbonyl]amino}-5-oxopentanoic acid
pharmaceutical intermediate for peptide synthesis
5-tert-Butyl N-((phenylmethoxy)carbonyl)-L-glutamate
Protected amino acid for peptide synthesis
BOC-DAP(Z)-OH
Peptide synthesis intermediate
(2R)-2-{[(benzyloxy)carbonyl]amino}butanedioic acid
Peptide synthesis intermediate
Boc-D-Asp(OBzl)-OH
Peptide synthesis intermediate
Fmoc-Glu(OtBu)-Phe-OH
Peptide synthesis intermediate
(4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid
VJECGKAFPHEJQS-ZDUSSCGKSA-N
CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1=CC=CC=C1