1-Bromo-3-nitrobenzene is a research compound classified by the International Agency for Research on Cancer (IARC) as possibly carcinogenic to humans (Group 2B). This classification is based on limited evidence of carcinogenicity in humans and sufficient evidence in experimental animals.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 585-79-5
8-Hydroxyquinoline-5-Carboxylic Acid
JmjC histone demethylase inhibitor
(1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine
Research compound for chiral ligand synthesis
Carnosine, D-
research compound
3-bromo-5-methylimidazo[1,2-a]pyridine
research compound
1-bromo-3-nitrobenzene
FWIROFMBWVMWLB-UHFFFAOYSA-N
C1=CC(=CC(=C1)Br)[N+](=O)[O-]