(R)-1-(4-nitrophenyl)ethanol is a research compound with a molecular structure featuring an aromatic ring, an alcohol group, and a nitro group. It is a chiral molecule with defined stereochemistry, commonly used as a laboratory reagent or intermediate in chemical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 58287-18-6
1-BROMO-2-IODOBENZENE
organic synthesis research reagent
4-(tert-Butyl)-2-(2,4-difluorophenyl)pyridine
research compound
Tetramethylammonium bicarbonate
Research reagent for organic synthesis
Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
research compound
(1R)-1-(4-nitrophenyl)ethanol
CRJFHXYELTYDSG-ZCFIWIBFSA-N
C[C@H](C1=CC=C(C=C1)[N+](=O)[O-])O