Methyl olivetolate is a chemical compound used as a pharmaceutical intermediate. It features a pentyl-substituted aromatic ring with hydroxyl groups and an ester functional group, contributing to its role in chemical synthesis for pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 58016-28-7
Ethyl 2,4-dihydroxy-6-pentylbenzoate
Lisdexamfetamine intermediate
6-Amino-5-ethyl-5-phenyl-2,4(3H,5H)-pyrimidinedione
Pharmaceutical impurity reference standard
2-Naphthylacetic acid
pharmaceutical intermediate
Tert-Butyl 1-amino-3,6,9,12-tetraoxapentadecan-15-oate
Polyethylene glycol linker for bioconjugation
1-(4-(3-Chloropropoxy)-3-methoxyphenyl)ethanone
Iloperidone intermediate
methyl 2,4-dihydroxy-6-pentylbenzoate
RQGAOBDPFOADCM-UHFFFAOYSA-N
CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC