meso-Hydrobenzoin is a chemical compound with two alcohol groups and two aromatic rings, commonly used as a research compound in laboratory settings. Its structure features defined stereochemistry, and it is primarily supplied for research and development purposes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 579-43-1
2-Methylpyridine-4-boronic acid
Boronic acid research reagent
ACEQUINOCYL-HYDROXY
reference standard
6-Amino-2,3-dimethylpyridine
research compound for chemical synthesis
4,4,4-trifluoro-1-(3-methoxyphenyl)-1,3-butanedione
research compound
(1S,2S)-1,2-diphenylethane-1,2-diol
Pharmaceutical intermediate
(1R,2R)-1,2-diphenylethane-1,2-diol
pharmaceutical intermediate
(1R,2S)-(-)-2-Amino-1,2-diphenylethanol
Intermediates for chiral pharmaceutical synthesis
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
(1R,2S)-1,2-diphenylethane-1,2-diol
IHPDTPWNFBQHEB-OKILXGFUSA-N
C1=CC=C(C=C1)[C@H]([C@H](C2=CC=CC=C2)O)O