2-(2,6-Dichlorophenoxy)acetic acid is a synthetic auxin herbicide compound used as an active ingredient in agrochemical formulations. It is structurally characterized by a dichlorinated aromatic ring linked to an acetic acid moiety, exhibiting moderate lipophilicity and a single carboxylic acid group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 575-90-6
2-(2,6-dichlorophenoxy)acetic acid
KHZWIIFEFQBNKL-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)OCC(=O)O)Cl