Alpha-Methyl-D-Tryptophan is a research compound structurally related to the amino acid tryptophan, which is involved in protein biosynthesis and serves as a precursor to serotonin, melatonin, and niacin. This derivative is primarily used in laboratory studies to investigate tryptophan metabolism and related biochemical pathways.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 56452-52-9
Furo[3,2-b]pyridine-5-carboxylic acid
research compound
3-aminothiophene-2-carbonitrile
research compound
1,1-dimethyl-2-(4-methoxyphenyl)ethylamine hydrochloride
pharmaceutical research intermediate
1-(4-methoxyphenyl)-2-methylpropan-2-amine
research compound
Alpha-Methyl-L-tryptophan
research compound for tryptophan metabolism studies
(2R)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid
ZTTWHZHBPDYSQB-GFCCVEGCSA-N
C[C@@](CC1=CNC2=CC=CC=C21)(C(=O)O)N