4-Bromo-3-methoxybenzoic acid is an organic compound featuring a bromine atom and a methoxy group on a benzoic acid ring. It is typically used as a building block or intermediate in organic synthesis and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 56256-14-5
4-bromo-3-methoxybenzoic acid
UEVXVBKBOFGKIN-UHFFFAOYSA-N
COC1=C(C=CC(=C1)C(=O)O)Br