(2-Amino-3-chlorophenyl)(phenyl)methanone is a substituted benzophenone compound used as an intermediate in the synthesis of benzodiazepines. Its structure features an amine group, two aromatic rings, and a chlorine atom.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5621-66-9
2',5-Dichloro-2-(methylamino)benzophenone
Pharmaceutical intermediate for benzodiazepine impurities
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
pharmaceutical intermediate
Piperazinone
pharmaceutical intermediate
4(3H)-Quinazolinone, 2-(fluoromethyl)-3-(2-methylphenyl)-6-nitro-
Pharmaceutical impurity reference standard
(2-amino-3-chlorophenyl)-phenylmethanone
JCPSDGBPFXACKB-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=C(C(=CC=C2)Cl)N