1-Chloro-9H-carbazole is a chlorinated derivative of carbazole, used primarily as a research compound. Its structure features three aromatic rings and a halogen substituent, contributing to its moderate lipophilicity and low polarity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5599-70-2
Benz[a]anthracene
Research chemical and reference standard
Gtp disodium salt
research reagent
(2H10)-o-Xylene
deuterated research standard
(3-tert-Butylphenyl)boronic acid
Research reagent for organic synthesis
1-chloro-9H-carbazole
DBDCPKPHHCECLZ-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Cl