Methyl 2,4-dichlorobenzeneacetate is an organic compound used as an agrochemical intermediate. It features a dichlorophenyl ring and an ester functional group, contributing to its role in the synthesis of other chemical products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 55954-23-9
Methyl 3-(4-hydroxyphenyl)propionate
nitrification inhibitor and plant growth regulator
Parathion
Insecticide and acaricide
Ethion
Organophosphate insecticide and acaricide
3-Chloro-2-methylpropene
chemical intermediate for insecticides
methyl 2-(2,4-dichlorophenyl)acetate
SRCVNBFTEARRJY-UHFFFAOYSA-N
COC(=O)CC1=C(C=C(C=C1)Cl)Cl