Alverine citrate is a salt form of alverine, a compound used as a pharmaceutical raw material. It functions as a smooth muscle relaxant, affecting involuntary muscles in the gastrointestinal tract.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5560-59-8
N-Phenylpropyl Alverine Hydrochloride
smooth muscle relaxant drug
3-Phenyl-N,N-bis(3-phenylpropyl)propan-1-amine
research compound
Tandetoron
pharmaceutical active ingredient
Nimustine hydrochloride
active pharmaceutical ingredient
Lumbokinase capsules
active pharmaceutical ingredient
Cephalonium
veterinary cephalosporin antibiotic
Alverine Impurity 19
nitrosamine reference standard
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid
RYHCACJBKCOBTJ-UHFFFAOYSA-N
CCN(CCCC1=CC=CC=C1)CCCC2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O