This compound is an organic molecule featuring a pyridine ring and a dimethylamino group connected by an unsaturated carbon chain. It is primarily recognized as a pharmaceutical intermediate used in chemical synthesis and manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 55314-16-4
5-aminopyridine-2-carbonitrile
pharmaceutical intermediate
9-Bromo-1-nonanol
Pharmaceutical intermediate for fulvestrant synthesis
3-(1-Cyanoethyl)benzoic acid
pharmaceutical intermediate
2-Acetoxybenzoyl chloride
Pharmaceutical intermediate for API synthesis
(E)-3-(dimethylamino)-1-pyridin-3-ylprop-2-en-1-one
MZLRFUCMBQWLNV-FNORWQNLSA-N
CN(C)/C=C/C(=O)C1=CN=CC=C1