Diphenyl(pentafluorophenyl)phosphine is a phosphine ligand used in coordination chemistry. Its structure features a phosphorus atom bonded to two phenyl rings and a pentafluorophenyl group, giving it distinct electronic properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5525-95-1
Nicotinic acid hydrazide
research compound
Hexanoic-2,2-d2 acid
deuterated research compound
Caproic acid-6,6,6-d3
deuterated reference standard for analytical chemistry
Phenyl vinyl sulfone
Research reagent for organic synthesis
(2,3,4,5,6-pentafluorophenyl)-diphenylphosphane
KUTXTUCJQJPJBH-UHFFFAOYSA-N
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C(=C(C(=C3F)F)F)F)F