Octaphenylcyclotetrasiloxane is a cyclic organosilicon compound primarily utilized as a precursor in the production of silicone materials. Its structure features eight phenyl groups attached to a siloxane ring, contributing to its non-polar character and high molecular weight.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 546-56-5
Titanium(IV) isopropoxide
Polymerization catalyst and paint additive
2-Methyl-3-nitrophenol
chemical intermediate for synthesis
Hydroxylamine hydrochloride
Organic synthesis reagent
2-acetoxy-1-ethoxypropane
Solvent in industrial coatings
2,2,4,4,6,6,8,8-octakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane
VSIKJPJINIDELZ-UHFFFAOYSA-N
C1=CC=C(C=C1)[Si]2(O[Si](O[Si](O[Si](O2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC=C9