This compound is a pharmaceutical intermediate featuring a phthalimide group linked to an epoxide ring. It is primarily used as a building block in organic synthesis for the preparation of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5455-98-1
3-amino-6-chloro-4-(2-chlorophenyl)-2-methyl-3,4-dihydro-4-quinazolinol
Pharmaceutical intermediate for triazolam impurities
Butyl cyanoacetate
pharmaceutical intermediate
Lithium acetate
Pharmaceutical raw material for drug synthesis
Boc-Lys(2-Cl-Z)-OH
Pharmaceutical intermediate for peptide synthesis
(S)-(+)-N-(2,3-Epoxypropyl)phthalimide
pharmaceutical intermediate
2-(oxiran-2-ylmethyl)isoindole-1,3-dione
DUILGEYLVHGSEE-UHFFFAOYSA-N
C1C(O1)CN2C(=O)C3=CC=CC=C3C2=O