2-Methoxy-5-nitropyridine is a chemical compound featuring a pyridine ring substituted with a methoxy group and a nitro group. It is commonly employed as an intermediate in organic synthesis and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5446-92-4
2-methoxy-5-nitropyridine
WUPLOZFIOAEYMG-UHFFFAOYSA-N
COC1=NC=C(C=C1)[N+](=O)[O-]