3-Aminophthalic acid is a chemical compound that forms as a product when luminol undergoes oxidation in the presence of a catalyst. It is primarily significant as a reagent used in chemiluminescence assays, including forensic applications where luminol and hydrogen peroxide are employed to detect traces of blood.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5434-20-8
1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride
research compound
5-(2-NITRO-PROPENYL)-BENZO(1,3)DIOXOLE
research compound
Cytidine 5'-diphosphate disodium salt
nucleoside diphosphate research reagent
1-IODOHEXADECANE
Laboratory reagent
Dimethylzinc
organometallic reagent for chemical synthesis
3-aminophthalic acid
WGLQHUKCXBXUDV-UHFFFAOYSA-N
C1=CC(=C(C(=C1)N)C(=O)O)C(=O)O