3-fluoro-2-nitropyridine is a fluorinated heteroaromatic compound used as a pharmaceutical intermediate. It is commonly supplied to the pharmaceutical and chemical manufacturing industries for the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 54231-35-5
3-Aminopyrazine-2-carboxylic acid
pharmaceutical intermediate for favipiravir synthesis
3-(dimethylamino)-1-(thiophen-2-yl)propan-1-one hydrochloride
pharmaceutical intermediate
N-ACETYLGLYCINE
pharmaceutical intermediate
Isobutyl chloroformate
Peptide reagent
3-fluoro-2-nitropyridine
IJVFHCSUEBAAOZ-UHFFFAOYSA-N
C1=CC(=C(N=C1)[N+](=O)[O-])F