[1,1'-Biphenyl]-4-ylmethyl acrylate is a research compound used primarily in laboratory and manufacturing settings. It features an ester functional group linking an acrylate moiety to a biphenyl ring system, imparting moderate lipophilicity and low polarity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 54140-58-8
Benzyl acrylate
polymerization monomer for acrylic resins
1,3,7-Trimethyluric acid
research compound
2-Hydroxy-5-nitropyridine
research compound
6-chloro-N-methylnicotinamide
research compound
3-oxopentanedioic acid
organic synthesis intermediate
(4-phenylphenyl)methyl prop-2-enoate
QBECDXJGYFRACA-UHFFFAOYSA-N
C=CC(=O)OCC1=CC=C(C=C1)C2=CC=CC=C2