Isonicotinic Acid-d4 is a deuterium-labeled derivative of isonicotinic acid, specifically the 2,3,5,6-tetradeuterio analog. It is primarily used as a stable isotope-labeled compound in research and analytical chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 53907-55-4
2,3,5,6-tetradeuteriopyridine-4-carboxylic acid
TWBYWOBDOCUKOW-RHQRLBAQSA-N
[2H]C1=C(N=C(C(=C1C(=O)O)[2H])[2H])[2H]