4-Bromo-3-nitrotoluene is a research compound that features a bromine atom and a nitro group on a toluene ring. Its structure is relevant for studying the ortho effect in substituted benzene compounds, a phenomenon that influences chemical properties through steric and polar interactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 5326-34-1
N-(4-methyl-2-pyridyl)acetamide
chemical research intermediate
2-ACETAMIDO-6-METHYLPYRIDINE
research compound
5-Hexynoic acid
terminal acetylenic compound for research
(2R,3R,4S,5R)-2-[6-amino-2-(phenylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol
Research nucleoside analog
1-bromo-4-methyl-2-nitrobenzene
UPBUTKQMDPHQAQ-UHFFFAOYSA-N
CC1=CC(=C(C=C1)Br)[N+](=O)[O-]