This compound is a chemical compound primarily used as an intermediate in pharmaceutical manufacturing. It contains a carbamate group and an ether functional group, contributing to its role in synthetic organic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 532410-39-2
5-Amino-3-bromo-2-methoxypyridine
Pharmaceutical intermediate for synthesis
2-(2-(4-Chlorophenyl)acetyl)benzoic acid
pharmaceutical intermediate
2-Chloro-4-(methylsulfonyl)benzoic acid
Pharmaceutical intermediate
2-Amino-5-iodobenzoic acid
Pharmaceutical intermediate for drug synthesis
tert-butyl N-methyl-N-(2-oxopropyl)carbamate
UJXOEXQSZFGUSO-UHFFFAOYSA-N
CC(=O)CN(C)C(=O)OC(C)(C)C