T-5224 is a small-molecule research compound that acts as an inhibitor of c-Fos/activator protein 1 (AP-1). It was originally investigated for potential use in rheumatoid arthritis but was never marketed, and is now primarily used in laboratory research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 530141-72-1
Iodomethyl pivalate
iodinated ester research reagent
2,3,4,6-Tetra-O-benzyl-D-galactose
Research compound for carbohydrate chemistry
Equol
Pharmaceutical research metabolite reference standard
2-Methylisothiouronium chloride
research compound
3-[5-(4-cyclopentyloxy-2-hydroxybenzoyl)-2-[(3-oxo-1,2-benzoxazol-6-yl)methoxy]phenyl]propanoic acid
DALCQQSLNPLQFZ-UHFFFAOYSA-N
C1CCC(C1)OC2=CC(=C(C=C2)C(=O)C3=CC(=C(C=C3)OCC4=CC5=C(C=C4)C(=O)NO5)CCC(=O)O)O