Sinapic acid is a matrix compound employed in matrix-assisted laser desorption/ionization (MALDI) mass spectrometry for the determination of protein molecular weights. It also occurs naturally as a constituent of propolis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 530-59-6
3,4,5-TRIMETHOXYCINNAMIC ACID
research compound
فيليبس سي دي-آي
coupling reagent for peptide synthesis
Beta-Tetralone
chemical research reagent
Cholic Acid-d5
deuterated reference standard
Sodium 3,5-difluorobenzoate
Chemical research reagent
3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid
PCMORTLOPMLEFB-UHFFFAOYSA-N
COC1=CC(=CC(=C1O)OC)C=CC(=O)O