1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt is a research reagent commonly used as a colorimetric or complexometric agent for the detection and determination of cobalt and potassium ions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 525-05-3
Tris (dibenzylideneaceton)dipalladum (O) chloroform adduct
organometallic catalyst for coupling reactions
2-Iodo-5-methylbenzoic acid
research reagent
Cholenic acid
research compound
5-Chloro-1-pentanol
Halogenated alcohol research reagent
disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate
DMKMTGULLYISBH-UHFFFAOYSA-L
C1=CC2=C(C(=C(C=C2C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])O)N=O.[Na+].[Na+]