6-Bromo-L-tryptophan is a halogenated derivative of the amino acid L-tryptophan. It is commonly used as a research compound, particularly in studies involving the kynurenine pathway, which is the major route of tryptophan metabolism.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 52448-17-6
AFMK
Metabolite of melatonin and antioxidant
Dichloro(p-cymene)ruthenium(II) dimer
organometallic chemistry and homogeneous catalysis reagent
Dichloro(mesitylene)ruthenium(II) dimer
organoruthenium reagent for catalysis
2-(4-Bromophenyl)naphtho[1,2-d]oxazole
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
(R)-2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
Peptide building block for research
(2S)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
OAORYCZPERQARS-VIFPVBQESA-N
C1=CC2=C(C=C1Br)NC=C2C[C@@H](C(=O)O)N