5-Chloro-2-nitropyridine is a chemical compound featuring a pyridine ring substituted with a chlorine atom and a nitro group. It is commonly used as an intermediate in organic synthesis and pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 52092-47-4
5-chloro-2-nitropyridine
YUBHMOQVHOODEI-UHFFFAOYSA-N
C1=CC(=NC=C1Cl)[N+](=O)[O-]