This compound is a research reagent primarily used in laboratory settings for chemical and biological studies. It features an aromatic ring and polar functional groups, indicating potential utility in synthetic chemistry and molecular investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 518047-98-8
Tris(2-carboxyethyl)phosphine hydrochloride
reducing agent in biochemistry
9,10-Dibromoanthracene-d8
deuterated research compound
5-Hydroxy-2-methoxypyridine
research compound
(R)-2-Amino-3-chloropropanoic acid hydrochloride
Research compound for biochemical studies
benzyl N-[(1Z)-1-amino-1-hydroxyimino-2-methylpropan-2-yl]carbamate
WWSJZCLRWHEHPA-UHFFFAOYSA-N
CC(C)(/C(=N/O)/N)NC(=O)OCC1=CC=CC=C1
—