Abietic acid is a diterpenoid naturally occurring in coniferous trees, where it is believed to play a role in defending the plant against insects and wounds. It is a chiral, tricyclic molecule containing two alkene groups and a carboxylic acid functional group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 514-10-3
1,1'-(Pentane-1,5-diyl)bis(1-methylpyrrolidinium) dibromide
Structure directing agent for zeolites
Sodium benzenesulfonate
Detergent and anionic surfactant
5,6,7,8-tetrahydronaphthalene-2-carbaldehyde
chemical intermediate for synthesis
9,10-Bis(phenylethynyl)-2-methylanthracene
Fluorescent dye and probe
(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
RSWGJHLUYNHPMX-ONCXSQPRSA-N
CC(C)C1=CC2=CC[C@@H]3[C@@]([C@H]2CC1)(CCC[C@@]3(C)C(=O)O)C