2-Chloro-1-(3,4-difluorophenyl)ethanone is a chemical compound primarily used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. It features a chlorinated ketone functional group attached to a difluorinated aromatic ring, which contributes to its reactivity in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 51336-95-9
2-(2-Aminoethyl)-1-methylpyrrolidine
Pharmaceutical intermediate
4-Benzyloxyaniline hydrochloride
pharmaceutical intermediate
5-Methylcyclocytidine hydrochlorine
Pharmaceutical intermediate for nucleoside analogs
1-(2-Ethylhexyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxonicotinonitrile
pharmaceutical intermediate
2-chloro-1-(3,4-difluorophenyl)ethanone
VMEDAWUIKFAFJQ-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)CCl)F)F