(2H10)Cyclohexanone is a fully deuterated analog of cyclohexanone, used as an analytical standard in research. Its isotopic labeling makes it valuable for mass spectrometry and nuclear magnetic resonance studies, particularly in structural chemistry investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء (2H10)Cyclohexanone؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Pentanedioic-d6 acid
deuterated analytical standard
1,2,3,4,5-pentadeuterio-6-methylbenzene
deuterated analytical standard
Tris(di(2H3)methylamido)phosphorus
Deuterated research compound
4-Biphenylboronic acid
research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-one
JHIVVAPYMSGYDF-YXALHFAPSA-N
[2H]C1(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]
هل تبحث عن شراء (2H10)Cyclohexanone؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.