1,2-Dibromopropane-d6 is a deuterated form of 1,2-dibromopropane used primarily as a solvent or reference standard in nuclear magnetic resonance spectroscopy. Its structure incorporates six deuterium atoms, providing a stable isotopic label for analytical and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 51209-47-3
Neodecaneperoxoic acid, 1,1,3,3-tetramethylbutyl ester
Polymerization initiator for PVC production
(4S)-4-methyl-1,3-dioxolan-2-one
cyclic carbonate solvent
1-Chloro-2-methylpropane
Organochlorine chemical intermediate
METHALLYL ALCOHOL
chemical process industry intermediate
1,2-dibromo-1,1,2,3,3,3-hexadeuteriopropane
XFNJYAKDBJUJAJ-LIDOUZCJSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])Br)Br