This compound is a chemical compound containing a benzodiazepine core structure, featuring amide and amine functional groups along with an aromatic halogen atom. It is primarily recognized as an intermediate in the synthesis of pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 50892-62-1
1-Chloroethyl chloroformate
Pharmaceutical intermediate for synthesis
3-(bromomethyl)benzamide
Pharmaceutical intermediate
4-(5-Methyl-3-phenyl-1,2-oxazol-4-yl)benzene-1-sulfonyl chloride
Pharmaceutical intermediate for valdecoxib synthesis
Ambroxol impurity c
Pharmaceutical reference standard impurity
8-Chloro-5,10-dihydro-5-nitroso-11H-dibenzo[b,e][1,4]diazepin-11-one
Nitroso impurity reference standard
3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one
YVWNDABPZGGQFE-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=O)NC3=C(N2)C=CC(=C3)Cl