2,5-Dichlorobenzoic acid is a chlorinated derivative of benzoic acid that typically appears as white needles or powder. It is primarily used as a chemical intermediate in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 50-79-3
2-Hydroxy-p-toluic acid
chemical intermediate for synthesis
3-Pyridinecarboxaldehyde
Chemical intermediate for synthesis
3-Fluorobenzyl cyanide
organic synthesis intermediate
CYCLOHEPTANOL
industrial solvent and chemical intermediate
2,5-dichlorobenzoic acid
QVTQYSFCFOGITD-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)C(=O)O)Cl