2,3-Dichlorobenzoic acid is a chlorinated aromatic carboxylic acid. It is a compound of interest in the study of mechanically flexible organic crystals, where weak intermolecular interactions contribute to its structural properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 50-45-3
2,3-dichlorobenzoic acid
QAOJBHRZQQDFHA-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)Cl)C(=O)O