4-Methyl-D-phenylalanine is a non-proteinogenic amino acid derivative with a methyl substituent on the aromatic ring. It serves as a specialized peptide building block in solid-phase synthesis, primarily for incorporating D-stereochemistry into peptide chains.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 49759-61-7
(2S,3R)-3-acetamido-2-hydroxy-4-phenylbutanoic acid
peptide building block for synthesis
Scopine
pharmaceutical intermediate
Isonipecotic acid
pharmaceutical intermediate
2-Azabicyclo[2.2.1]hept-5-en-3-one
Pharmaceutical intermediate for abacavir synthesis
Mercaptopurine disulfide
Pharmaceutical intermediate for thiopurine derivatives
4-Methyl-L-phenylalanine
Research compound for peptide synthesis
(2R)-2-amino-3-(4-methylphenyl)propanoic acid
DQLHSFUMICQIMB-SECBINFHSA-N
CC1=CC=C(C=C1)C[C@H](C(=O)O)N