Mandyphos SL-M004-1 is a chiral ligand used in asymmetric catalysis, primarily employed as a research reagent. Its structure, derived from evidence, indicates a salt-like, multi-fragment organometallic compound containing iron, with features such as amine and ether functional groups and aromatic rings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 494227-37-1
(S)-(+)-N,N-Dimethyl-1-((R)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
(R)-(-)-N,N-Dimethyl-1-((S)-2-(diphenylphosphino)ferrocenyl)ethylamine
chiral ligand for asymmetric catalysis
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(bis(4-methoxy-3,5-bis(2-methyl-2-propanyl)phenyl)phosphine)
chiral ligand for asymmetric catalysis
(1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene
chiral ligand for asymmetric catalysis
(D-Lys16)-ACTH (1-24) (human, bovine, rat) trifluoroacetate salt
research reagent for receptor studies
2-fluoropyrazine
research compound
N-Hydroxybenzamide
analytical reagent and research compound
Indoline
research compound
HEJIDMKBSDYNOY-UHFFFAOYSA-N
CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.CC1=CC(=CC(=C1OC)C)P([C]2[CH][CH][CH][C]2C(C3=CC=CC=C3)N(C)C)C4=CC(=C(C(=C4)C)OC)C.[Fe]