Hypaphorine is an amino acid betaine derived from L-tryptophan, characterized by a quaternary ammonium group and a zwitterionic structure. It is a naturally occurring compound found in plants and fungi, such as Pisolithus tinctorius and Caragana sinica, and serves as a metabolite in these organisms.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 487-58-1
Kainic acid
research compound for neuroscience studies
3-Formylindole
crystallographic reference compound
1-(1H-Imidazol-1-yl)butane-1,3-dione
chemical research reagent
INDOLE-3-CARBOXALDEHYDE
research compound
(2S)-3-(1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate
AOHCBEAZXHZMOR-ZDUSSCGKSA-N
C[N+](C)(C)[C@@H](CC1=CNC2=CC=CC=C21)C(=O)[O-]