This compound is a boronic acid derivative of an indole, featuring a tert-butyloxycarbonyl (Boc) protecting group and a bromine substituent. It is primarily used as a pharmaceutical intermediate in chemical synthesis, facilitating the construction of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 475102-13-7
Methyl 2-chloroacetoacetate
Pharmaceutical intermediate for synthesis
1-boc-3-cyanopyrrolidine
pharmaceutical intermediate
5-BROMO-2-IODO-3-METHOXYPYRAZINE
Pharmaceutical intermediate
Boc-Tyr(2-Br-Z)-OH
Protected amino acid for peptide synthesis
[5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid
RBYTXZMVOGZESQ-UHFFFAOYSA-N
B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Br)(O)O