Dichloramine B is an This compound compound used primarily as a disinfectant and antiseptic agent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 473-29-0
Chloramine-T trihydrate
Disinfectant and antiseptic agent
Iodine
Disinfectant and antiseptic agent
تسجيلات كابيتول
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
N-Methyl-o-phenylenediamine
chemical intermediate for dyes and pigments
2,2-Bis(hydroxymethyl)propionic acid
Biodegradable polymer and coating intermediate
N,N-dichlorobenzenesulfonamide
PJBJJXCZRAHMCK-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N(Cl)Cl