2,3-Difluorobenzoic acid is a fluorinated benzoic acid derivative primarily used as a research compound. Its structure features a carboxylic acid group attached to a fluorinated aromatic ring, making it of interest in crystallographic and synthetic chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4519-39-5
2,3-difluorobenzoic acid
JLZVIWSFUPLSOR-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)F)C(=O)O