5-Fluoro-2-nitrophenol is a fluorinated aromatic compound containing both a nitro group and a hydroxyl group on a benzene ring. It is primarily used as a research reagent in laboratory settings for the synthesis of more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 446-36-6
3-Fluoro-4-nitroanisole
research compound
2-Fluorobenzyl bromide
Research reagent for organic synthesis
Benzenemethanol, 2-fluoro-
organic synthesis building block
2-Fluorophenylmagnesium bromide
organometallic reagent for synthesis
5-fluoro-2-nitrophenol
QQURWFRNETXFTN-UHFFFAOYSA-N
C1=CC(=C(C=C1F)O)[N+](=O)[O-]