4-Fluoro-3-propylbenzoic acid is a fluorinated benzoic acid derivative used as a research compound. Its structure features a carboxylic acid group, an aromatic ring, and a fluorine atom, contributing to its properties as a laboratory reagent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 445018-80-4
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Boronic ester for Suzuki coupling
1,4-Dihydro-1,4-methanonaphthalene
research compound
3-(difluoromethyl)-4-fluoroaniline
research compound
Nicotinamide Riboside Triflate
Research compound for NAD+ metabolism
4-fluoro-3-propylbenzoic acid
CWGCZLDQVNFBMO-UHFFFAOYSA-N
CCCC1=C(C=CC(=C1)C(=O)O)F